C24H30FNO3S — CID 66591347
3-[2-fluoro-4-[4-[[methyl(nonanoyl)amino]methyl]thiophen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 66591347) has the molecular formula C24H30FNO3S and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-[2-fluoro-4-[4-[[methyl(nonanoyl)amino]methyl]thiophen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-fluoro-4-[4-[[methyl(nonanoyl)amino]methyl]thiophen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66591347 |
| Molecular Formula | C24H30FNO3S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[2-fluoro-4-[4-[[methyl(nonanoyl)amino]methyl]thiophen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCCCCC(=O)N(C)Cc1csc(-c2ccc(C=CC(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C24H30FNO3S/c1-3-4-5-6-7-8-9-23(27)26(2)16-18-14-22(30-17-18)20-11-10-19(21(25)15-20)12-13-24(28)29/h10-15,17H,3-9,16H2,1-2H3,(H,28,29) |
| InChIKey | BTOBWPRTCXAGOH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|