About dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate
dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate (PubChem CID 66591945) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate |
| PubChem CID | 66591945 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate |
| SMILES | COC(=O)C1CCC2OC1CCC2C(=O)OC |
| InChI | InChI=1S/C12H18O5/c1-15-11(13)7-3-5-10-8(12(14)16-2)4-6-9(7)17-10/h7-10H,3-6H2,1-2H3 |
| InChIKey | FYDMVQYCQZPYTE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate?
The IUPAC name of dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate (CID 66591945) is dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate.
What is the SMILES notation for dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate?
The canonical SMILES for dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate is COC(=O)C1CCC2OC1CCC2C(=O)OC.
What is the InChIKey of dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate?
The InChIKey is FYDMVQYCQZPYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-15-11(13)7-3-5-10-8(12(14)16-2)4-6-9(7)17-10/h7-10H,3-6H2,1-2H3.
What are the key properties of dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate?
dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate has a molecular weight of 242.27 g/mol, XLogP of 0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 9-oxabicyclo[3.3.1]nonane-2,6-dicarboxylate is sourced from PubChem (CID 66591945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).