About (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride
(3S,4R)-3,4-diethoxypyrrolidine;hydrochloride (PubChem CID 66592002) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride |
| PubChem CID | 66592002 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride |
| SMILES | CCO[C@H]1CNC[C@H]1OCC.Cl |
| InChI | InChI=1S/C8H17NO2.ClH/c1-3-10-7-5-9-6-8(7)11-4-2;/h7-9H,3-6H2,1-2H3;1H/t7-,8+; |
| InChIKey | KMGUJVILJIFZPZ-KVZVIFLMSA-N |
| XLogP | 0.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride?
The IUPAC name of (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride (CID 66592002) is (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride.
What is the SMILES notation for (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride?
The canonical SMILES for (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride is CCO[C@H]1CNC[C@H]1OCC.Cl.
What is the InChIKey of (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride?
The InChIKey is KMGUJVILJIFZPZ-KVZVIFLMSA-N. The full InChI is InChI=1S/C8H17NO2.ClH/c1-3-10-7-5-9-6-8(7)11-4-2;/h7-9H,3-6H2,1-2H3;1H/t7-,8+;.
What are the key properties of (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride?
(3S,4R)-3,4-diethoxypyrrolidine;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-diethoxypyrrolidine;hydrochloride is sourced from PubChem (CID 66592002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).