C28H32NO6S2+ — CID 66592747
methyl 3-[3-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]propoxy]benzoate (PubChem CID 66592747) has the molecular formula C28H32NO6S2+ and a molecular weight of 542.70 g/mol. Its IUPAC name is methyl 3-[3-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]propoxy]benzoate.
| Compound Name | methyl 3-[3-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 66592747 |
| Molecular Formula | C28H32NO6S2+ |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | methyl 3-[3-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCC[N+]23CCC(CC2)[C@@H](OC(=O)C(O)(c2cccs2)c2cccs2)C3)c1 |
| InChI | InChI=1S/C28H32NO6S2/c1-33-26(30)21-6-2-7-22(18-21)34-15-5-12-29-13-10-20(11-14-29)23(19-29)35-27(31)28(32,24-8-3-16-36-24)25-9-4-17-37-25/h2-4,6-9,16-18,20,23,32H,5,10-15,19H2,1H3/q+1/t20?,23-,29?/m0/s1 |
| InChIKey | IYAJLBSDYXWQFL-OTQLNIJOSA-N |
| XLogP | 4.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|