About 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid
2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid (PubChem CID 66592978) has the molecular formula C19H17N3O2S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid |
| PubChem CID | 66592978 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc2c(c1)sc1nc(-c3ccc(N)cc3)cn12 |
| InChI | InChI=1S/C19H17N3O2S/c1-2-14(18(23)24)12-5-8-16-17(9-12)25-19-21-15(10-22(16)19)11-3-6-13(20)7-4-11/h3-10,14H,2,20H2,1H3,(H,23,24) |
| InChIKey | SBRFYHNWVWUXBS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid?
The IUPAC name of 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid (CID 66592978) is 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid.
What is the SMILES notation for 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid?
The canonical SMILES for 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid is CCC(C(=O)O)c1ccc2c(c1)sc1nc(-c3ccc(N)cc3)cn12.
What is the InChIKey of 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid?
The InChIKey is SBRFYHNWVWUXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2S/c1-2-14(18(23)24)12-5-8-16-17(9-12)25-19-21-15(10-22(16)19)11-3-6-13(20)7-4-11/h3-10,14H,2,20H2,1H3,(H,23,24).
What are the key properties of 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid?
2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid has a molecular weight of 351.43 g/mol, XLogP of 4.38, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-aminophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]butanoic acid is sourced from PubChem (CID 66592978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).