About 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride
4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride (PubChem CID 66593025) has the molecular formula C13H17ClF3NO2
and a molecular weight of 311.73 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride |
| PubChem CID | 66593025 |
| Molecular Formula | C13H17ClF3NO2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)COc1ccc(OC2CCNCC2)cc1 |
| InChI | InChI=1S/C13H16F3NO2.ClH/c14-13(15,16)9-18-10-1-3-11(4-2-10)19-12-5-7-17-8-6-12;/h1-4,12,17H,5-9H2;1H |
| InChIKey | MWKRBKIVYJRCJW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride?
The IUPAC name of 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride (CID 66593025) is 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride.
What is the SMILES notation for 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride?
The canonical SMILES for 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride is Cl.FC(F)(F)COc1ccc(OC2CCNCC2)cc1.
What is the InChIKey of 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride?
The InChIKey is MWKRBKIVYJRCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO2.ClH/c14-13(15,16)9-18-10-1-3-11(4-2-10)19-12-5-7-17-8-6-12;/h1-4,12,17H,5-9H2;1H.
What are the key properties of 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride?
4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride has a molecular weight of 311.73 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidine;hydrochloride is sourced from PubChem (CID 66593025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).