C22H18ClN5O3 — CID 66593440
1-N-(4-chlorophenyl)-2-N-[4-(2-oxopyrazin-1-yl)phenyl]-2,5-dihydropyrrole-1,2-dicarboxamide (PubChem CID 66593440) has the molecular formula C22H18ClN5O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-2-N-[4-(2-oxopyrazin-1-yl)phenyl]-2,5-dihydropyrrole-1,2-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-2-N-[4-(2-oxopyrazin-1-yl)phenyl]-2,5-dihydropyrrole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 66593440 |
| Molecular Formula | C22H18ClN5O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-N-(4-chlorophenyl)-2-N-[4-(2-oxopyrazin-1-yl)phenyl]-2,5-dihydropyrrole-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(-n2ccncc2=O)cc1)C1C=CCN1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClN5O3/c23-15-3-5-17(6-4-15)26-22(31)28-12-1-2-19(28)21(30)25-16-7-9-18(10-8-16)27-13-11-24-14-20(27)29/h1-11,13-14,19H,12H2,(H,25,30)(H,26,31) |
| InChIKey | GGHPMOKDRZKXAP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|