About porphyrin;zinc
porphyrin;zinc (PubChem CID 66593577) has the molecular formula C20H12N4Zn
and a molecular weight of 373.73 g/mol. Its IUPAC name is porphyrin;zinc.
Molecular Properties
| Compound Name | porphyrin;zinc |
| PubChem CID | 66593577 |
| Molecular Formula | C20H12N4Zn |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | porphyrin;zinc |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Zn] |
| InChI | InChI=1S/C20H12N4.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | ACTQXWMLJDUEEH-QDJBTJTOSA-N |
| XLogP | 3.58 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze porphyrin;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of porphyrin;zinc?
The IUPAC name of porphyrin;zinc (CID 66593577) is porphyrin;zinc.
What is the SMILES notation for porphyrin;zinc?
The canonical SMILES for porphyrin;zinc is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Zn].
What is the InChIKey of porphyrin;zinc?
The InChIKey is ACTQXWMLJDUEEH-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H12N4.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of porphyrin;zinc?
porphyrin;zinc has a molecular weight of 373.73 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for porphyrin;zinc is sourced from PubChem (CID 66593577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).