C38H31BrN4 — CID 66593603
10-bromo-5,15-bis(2,4,6-trimethylphenyl)porphyrin (PubChem CID 66593603) has the molecular formula C38H31BrN4 and a molecular weight of 623.60 g/mol. Its IUPAC name is 10-bromo-5,15-bis(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 10-bromo-5,15-bis(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 66593603 |
| Molecular Formula | C38H31BrN4 |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 10-bromo-5,15-bis(2,4,6-trimethylphenyl)porphyrin |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C(Br)=C3/C=CC2=N3)c(C)c1 |
| InChI | InChI=1S/C38H31BrN4/c1-20-15-22(3)34(23(4)16-20)36-28-9-7-26(40-28)19-27-8-10-29(41-27)37(35-24(5)17-21(2)18-25(35)6)31-12-14-33(43-31)38(39)32-13-11-30(36)42-32/h7-19H,1-6H3/b26-19-,27-19-,36-28+,36-30+,37-29+,37-31+,38-32+,38-33+ |
| InChIKey | KKDRNSCUGDXTEO-ZBQJGTLDSA-N |
| XLogP | 9.21 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |