C38H32N4 — CID 66593779
5,15-bis(2,4,6-trimethylphenyl)porphyrin (PubChem CID 66593779) has the molecular formula C38H32N4 and a molecular weight of 544.70 g/mol. Its IUPAC name is 5,15-bis(2,4,6-trimethylphenyl)porphyrin.
| Compound Name | 5,15-bis(2,4,6-trimethylphenyl)porphyrin |
|---|---|
| PubChem CID | 66593779 |
| Molecular Formula | C38H32N4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 5,15-bis(2,4,6-trimethylphenyl)porphyrin |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C=C3/C=CC2=N3)c(C)c1 |
| InChI | InChI=1S/C38H32N4/c1-21-15-23(3)35(24(4)16-21)37-31-11-7-27(39-31)19-29-9-13-33(41-29)38(36-25(5)17-22(2)18-26(36)6)34-14-10-30(42-34)20-28-8-12-32(37)40-28/h7-20H,1-6H3/b27-19-,28-20-,29-19-,30-20-,37-31+,37-32+,38-33+,38-34+ |
| InChIKey | SKZHCULCJHAUKX-RQUSAZMDSA-N |
| XLogP | 8.48 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |