About 7-ethenyl-1,2,6-trimethoxynaphthalene
7-ethenyl-1,2,6-trimethoxynaphthalene (PubChem CID 66593812) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 7-ethenyl-1,2,6-trimethoxynaphthalene.
Molecular Properties
| Compound Name | 7-ethenyl-1,2,6-trimethoxynaphthalene |
| PubChem CID | 66593812 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 7-ethenyl-1,2,6-trimethoxynaphthalene |
| SMILES | C=Cc1cc2c(OC)c(OC)ccc2cc1OC |
| InChI | InChI=1S/C15H16O3/c1-5-10-8-12-11(9-14(10)17-3)6-7-13(16-2)15(12)18-4/h5-9H,1H2,2-4H3 |
| InChIKey | VIQCEKZDUQKMKD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethenyl-1,2,6-trimethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-1,2,6-trimethoxynaphthalene?
The IUPAC name of 7-ethenyl-1,2,6-trimethoxynaphthalene (CID 66593812) is 7-ethenyl-1,2,6-trimethoxynaphthalene.
What is the SMILES notation for 7-ethenyl-1,2,6-trimethoxynaphthalene?
The canonical SMILES for 7-ethenyl-1,2,6-trimethoxynaphthalene is C=Cc1cc2c(OC)c(OC)ccc2cc1OC.
What is the InChIKey of 7-ethenyl-1,2,6-trimethoxynaphthalene?
The InChIKey is VIQCEKZDUQKMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3/c1-5-10-8-12-11(9-14(10)17-3)6-7-13(16-2)15(12)18-4/h5-9H,1H2,2-4H3.
What are the key properties of 7-ethenyl-1,2,6-trimethoxynaphthalene?
7-ethenyl-1,2,6-trimethoxynaphthalene has a molecular weight of 244.29 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-1,2,6-trimethoxynaphthalene is sourced from PubChem (CID 66593812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).