About 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline
2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline (PubChem CID 66593869) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline.
Molecular Properties
| Compound Name | 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline |
| PubChem CID | 66593869 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline |
| SMILES | CC1=CCC(C)=C1c1ccccc1N |
| InChI | InChI=1S/C13H15N/c1-9-7-8-10(2)13(9)11-5-3-4-6-12(11)14/h3-7H,8,14H2,1-2H3 |
| InChIKey | VEMHYRVMGSKMDS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline?
The IUPAC name of 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline (CID 66593869) is 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline.
What is the SMILES notation for 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline?
The canonical SMILES for 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline is CC1=CCC(C)=C1c1ccccc1N.
What is the InChIKey of 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline?
The InChIKey is VEMHYRVMGSKMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-9-7-8-10(2)13(9)11-5-3-4-6-12(11)14/h3-7H,8,14H2,1-2H3.
What are the key properties of 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline?
2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline has a molecular weight of 185.27 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylcyclopenta-1,4-dien-1-yl)aniline is sourced from PubChem (CID 66593869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).