C52H44N4O2 — CID 66593893
[4-[15-[4-(hydroxymethyl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]methanol (PubChem CID 66593893) has the molecular formula C52H44N4O2 and a molecular weight of 756.95 g/mol. Its IUPAC name is [4-[15-[4-(hydroxymethyl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]methanol.
| Compound Name | [4-[15-[4-(hydroxymethyl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 66593893 |
| Molecular Formula | C52H44N4O2 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | [4-[15-[4-(hydroxymethyl)phenyl]-10,20-bis(2,4,6-trimethylphenyl)porphyrin-5-yl]phenyl]methanol |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C(c3ccc(CO)cc3)=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C(c3ccc(CO)cc3)=C3/C=CC2=N3)c(C)c1 |
| InChI | InChI=1S/C52H44N4O2/c1-29-23-31(3)47(32(4)24-29)51-43-19-15-39(53-43)49(37-11-7-35(27-57)8-12-37)41-17-21-45(55-41)52(48-33(5)25-30(2)26-34(48)6)46-22-18-42(56-46)50(40-16-20-44(51)54-40)38-13-9-36(28-58)10-14-38/h7-26,57-58H,27-28H2,1-6H3/b49-39-,49-41-,50-40-,50-42-,51-43+,51-44+,52-45+,52-46+ |
| InChIKey | VFWSXRJRUFOJKT-ZABGCZTGSA-N |
| XLogP | 10.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |