About 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid
2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid (PubChem CID 66594029) has the molecular formula C18H34N2O5
and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid |
| PubChem CID | 66594029 |
| Molecular Formula | C18H34N2O5 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid |
| SMILES | CC(C)COC(=O)N1CCCCC1CCO.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C12H23NO3.C6H11NO2/c1-10(2)9-16-12(15)13-7-4-3-5-11(13)6-8-14;8-6(9)7-4-2-1-3-5-7/h10-11,14H,3-9H2,1-2H3;1-5H2,(H,8,9) |
| InChIKey | OPBKDZCEBNGFRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid?
The IUPAC name of 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid (CID 66594029) is 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid.
What is the SMILES notation for 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid?
The canonical SMILES for 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid is CC(C)COC(=O)N1CCCCC1CCO.O=C(O)N1CCCCC1.
What is the InChIKey of 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid?
The InChIKey is OPBKDZCEBNGFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3.C6H11NO2/c1-10(2)9-16-12(15)13-7-4-3-5-11(13)6-8-14;8-6(9)7-4-2-1-3-5-7/h10-11,14H,3-9H2,1-2H3;1-5H2,(H,8,9).
What are the key properties of 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid?
2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid has a molecular weight of 358.48 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;piperidine-1-carboxylic acid is sourced from PubChem (CID 66594029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).