About trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride
trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride (PubChem CID 66594094) has the molecular formula C10H23ClN2O
and a molecular weight of 222.76 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride |
| PubChem CID | 66594094 |
| Molecular Formula | C10H23ClN2O |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride |
| SMILES | COCCNC[C@@H]1CCCC[C@@H]1N.Cl |
| InChI | InChI=1S/C10H22N2O.ClH/c1-13-7-6-12-8-9-4-2-3-5-10(9)11;/h9-10,12H,2-8,11H2,1H3;1H/t9-,10-;/m0./s1 |
| InChIKey | ROBCADRBALBYKE-IYPAPVHQSA-N |
| XLogP | 1.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride?
The IUPAC name of trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride (CID 66594094) is trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride.
What is the SMILES notation for trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride?
The canonical SMILES for trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride is COCCNC[C@@H]1CCCC[C@@H]1N.Cl.
What is the InChIKey of trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride?
The InChIKey is ROBCADRBALBYKE-IYPAPVHQSA-N. The full InChI is InChI=1S/C10H22N2O.ClH/c1-13-7-6-12-8-9-4-2-3-5-10(9)11;/h9-10,12H,2-8,11H2,1H3;1H/t9-,10-;/m0./s1.
What are the key properties of trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride?
trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride has a molecular weight of 222.76 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-[(2-methoxyethylamino)methyl]cyclohexan-1-amine;hydrochloride is sourced from PubChem (CID 66594094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).