C20H21FN4O6S — CID 66594349
N-[(4-fluorophenyl)methyl]-11-hydroxy-4-methylsulfonyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 66594349) has the molecular formula C20H21FN4O6S and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-11-hydroxy-4-methylsulfonyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-4-methylsulfonyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 66594349 |
| Molecular Formula | C20H21FN4O6S |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-4-methylsulfonyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CS(=O)(=O)N1CCCN2C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)cc4)cn3CC21 |
| InChI | InChI=1S/C20H21FN4O6S/c1-32(30,31)25-8-2-7-24-15(25)11-23-10-14(17(26)18(27)16(23)20(24)29)19(28)22-9-12-3-5-13(21)6-4-12/h3-6,10,15,27H,2,7-9,11H2,1H3,(H,22,28) |
| InChIKey | XLHOQIXGJBPVNC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |