C13H27N3 — CID 66594466
trans-(1S,2S)-2-[(2-pyrrolidin-1-ylethylamino)methyl]cyclohexan-1-amine (PubChem CID 66594466) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(2-pyrrolidin-1-ylethylamino)methyl]cyclohexan-1-amine.
| Compound Name | trans-(1S,2S)-2-[(2-pyrrolidin-1-ylethylamino)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 66594466 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | trans-(1S,2S)-2-[(2-pyrrolidin-1-ylethylamino)methyl]cyclohexan-1-amine |
| SMILES | N[C@H]1CCCC[C@H]1CNCCN1CCCC1 |
| InChI | InChI=1S/C13H27N3/c14-13-6-2-1-5-12(13)11-15-7-10-16-8-3-4-9-16/h12-13,15H,1-11,14H2/t12-,13-/m0/s1 |
| InChIKey | USZKXTHOSPEZQL-STQMWFEESA-N |
| XLogP | 1.19 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|