C16H14N4O — CID 66594635
2,10,17-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),4,6,8,11,13,15-heptaene-15-carboxamide (PubChem CID 66594635) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 2,10,17-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),4,6,8,11,13,15-heptaene-15-carboxamide.
| Compound Name | 2,10,17-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),4,6,8,11,13,15-heptaene-15-carboxamide |
|---|---|
| PubChem CID | 66594635 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,10,17-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),4,6,8,11,13,15-heptaene-15-carboxamide |
| SMILES | NC(=O)C1=CN2C=C3N(C=CC4=CC=CCN43)C=C2C=C1 |
| InChI | InChI=1S/C16H14N4O/c17-16(21)12-4-5-14-10-18-8-6-13-3-1-2-7-20(13)15(18)11-19(14)9-12/h1-6,8-11H,7H2,(H2,17,21) |
| InChIKey | AOSAXOGNPFZXRJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |