C18H25NO5 — CID 66594649
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5-carboxylic acid;2-hydroxy-2-phenylacetic acid (PubChem CID 66594649) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5-carboxylic acid;2-hydroxy-2-phenylacetic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5-carboxylic acid;2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 66594649 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-5-carboxylic acid;2-hydroxy-2-phenylacetic acid |
| SMILES | O=C(O)C(O)c1ccccc1.O=C(O)C1CCCC2CNCCC21 |
| InChI | InChI=1S/C10H17NO2.C8H8O3/c12-10(13)9-3-1-2-7-6-11-5-4-8(7)9;9-7(8(10)11)6-4-2-1-3-5-6/h7-9,11H,1-6H2,(H,12,13);1-5,7,9H,(H,10,11) |
| InChIKey | IANJAYZERQKHEU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |