About 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone
2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone (PubChem CID 66595179) has the molecular formula C18H14N4O3
and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone |
| PubChem CID | 66595179 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone |
| SMILES | O=C(C=C1Nc2ccc([N+](=O)[O-])cc2C2=NCCN12)c1ccccc1 |
| InChI | InChI=1S/C18H14N4O3/c23-16(12-4-2-1-3-5-12)11-17-20-15-7-6-13(22(24)25)10-14(15)18-19-8-9-21(17)18/h1-7,10-11,20H,8-9H2 |
| InChIKey | AQFRIOWURJLVKI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone?
The IUPAC name of 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone (CID 66595179) is 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone.
What is the SMILES notation for 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone?
The canonical SMILES for 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone is O=C(C=C1Nc2ccc([N+](=O)[O-])cc2C2=NCCN12)c1ccccc1.
What is the InChIKey of 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone?
The InChIKey is AQFRIOWURJLVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O3/c23-16(12-4-2-1-3-5-12)11-17-20-15-7-6-13(22(24)25)10-14(15)18-19-8-9-21(17)18/h1-7,10-11,20H,8-9H2.
What are the key properties of 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone?
2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone has a molecular weight of 334.34 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-nitro-3,6-dihydro-2H-imidazo[1,2-c]quinazolin-5-ylidene)-1-phenylethanone is sourced from PubChem (CID 66595179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).