About bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate
bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate (PubChem CID 66595332) has the molecular formula C18H12Br4O6
and a molecular weight of 643.90 g/mol. Its IUPAC name is bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate.
Molecular Properties
| Compound Name | bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate |
| PubChem CID | 66595332 |
| Molecular Formula | C18H12Br4O6 |
| Molecular Weight | 643.90 g/mol |
| Exact Mass | 639.74 |
| IUPAC Name | bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCc1cc(Br)cc(Br)c1O)OCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C18H12Br4O6/c19-11-3-9(17(25)13(21)5-11)7-27-15(23)1-2-16(24)28-8-10-4-12(20)6-14(22)18(10)26/h1-6,25-26H,7-8H2/b2-1+ |
| InChIKey | HMVBUCRJXYETAA-OWOJBTEDSA-N |
| XLogP | 5.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate?
The IUPAC name of bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate (CID 66595332) is bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate.
What is the SMILES notation for bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate?
The canonical SMILES for bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate is O=C(/C=C/C(=O)OCc1cc(Br)cc(Br)c1O)OCc1cc(Br)cc(Br)c1O.
What is the InChIKey of bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate?
The InChIKey is HMVBUCRJXYETAA-OWOJBTEDSA-N. The full InChI is InChI=1S/C18H12Br4O6/c19-11-3-9(17(25)13(21)5-11)7-27-15(23)1-2-16(24)28-8-10-4-12(20)6-14(22)18(10)26/h1-6,25-26H,7-8H2/b2-1+.
What are the key properties of bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate?
bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate has a molecular weight of 643.90 g/mol, XLogP of 5.49, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(3,5-dibromo-2-hydroxyphenyl)methyl] (E)-but-2-enedioate is sourced from PubChem (CID 66595332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).