C23H41N3O4 — CID 66595387
ethyl (E)-4-[[3,3-dimethyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 66595387) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is ethyl (E)-4-[[3,3-dimethyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E)-4-[[3,3-dimethyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 66595387 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | ethyl (E)-4-[[3,3-dimethyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(NC(=O)[C@@H]1CCCCN1)C(C)(C)C |
| InChI | InChI=1S/C23H41N3O4/c1-9-30-22(29)16(4)14-18(15(2)3)26(8)21(28)19(23(5,6)7)25-20(27)17-12-10-11-13-24-17/h14-15,17-19,24H,9-13H2,1-8H3,(H,25,27)/b16-14+/t17-,18?,19?/m0/s1 |
| InChIKey | RNZDXLBAYOZIBJ-GCIVDCCSSA-N |
| XLogP | 2.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|