C24H42N3O6P — CID 66595520
[(2S)-3-[[(2S)-2-[[(2S)-2-anilino-3-methylbutanoyl]amino]propanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid;hydrate (PubChem CID 66595520) has the molecular formula C24H42N3O6P and a molecular weight of 499.59 g/mol. Its IUPAC name is [(2S)-3-[[(2S)-2-[[(2S)-2-anilino-3-methylbutanoyl]amino]propanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid;hydrate.
| Compound Name | [(2S)-3-[[(2S)-2-[[(2S)-2-anilino-3-methylbutanoyl]amino]propanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid;hydrate |
|---|---|
| PubChem CID | 66595520 |
| Molecular Formula | C24H42N3O6P |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | [(2S)-3-[[(2S)-2-[[(2S)-2-anilino-3-methylbutanoyl]amino]propanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid;hydrate |
| SMILES | CC(C)[C@H](Nc1ccccc1)C(=O)N[C@@H](C)C(=O)NC[C@H](O)CP(=O)(O)CC1CCCCC1.O |
| InChI | InChI=1S/C24H40N3O5P.H2O/c1-17(2)22(27-20-12-8-5-9-13-20)24(30)26-18(3)23(29)25-14-21(28)16-33(31,32)15-19-10-6-4-7-11-19;/h5,8-9,12-13,17-19,21-22,27-28H,4,6-7,10-11,14-16H2,1-3H3,(H,25,29)(H,26,30)(H,31,32);1H2/t18-,21-,22-;/m0./s1 |
| InChIKey | MCTWDZNEDLPPQX-OVXWWNFRSA-N |
| XLogP | 2.13 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|