About 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane
2-hexyl-6-methyl-1,3,6,2-dioxazaborocane (PubChem CID 66595874) has the molecular formula C11H24BNO2
and a molecular weight of 213.13 g/mol. Its IUPAC name is 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane |
| PubChem CID | 66595874 |
| Molecular Formula | C11H24BNO2 |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane |
| SMILES | CCCCCCB1OCCN(C)CCO1 |
| InChI | InChI=1S/C11H24BNO2/c1-3-4-5-6-7-12-14-10-8-13(2)9-11-15-12/h3-11H2,1-2H3 |
| InChIKey | XPWSNUXJBZWINO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane?
The IUPAC name of 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane (CID 66595874) is 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane is CCCCCCB1OCCN(C)CCO1.
What is the InChIKey of 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane?
The InChIKey is XPWSNUXJBZWINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24BNO2/c1-3-4-5-6-7-12-14-10-8-13(2)9-11-15-12/h3-11H2,1-2H3.
What are the key properties of 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane?
2-hexyl-6-methyl-1,3,6,2-dioxazaborocane has a molecular weight of 213.13 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-6-methyl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 66595874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).