About 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate
1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate (PubChem CID 66596169) has the molecular formula C23H35NO6Si
and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate |
| PubChem CID | 66596169 |
| Molecular Formula | C23H35NO6Si |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)CCN(C(=O)OCc2ccccc2)C1CCC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C23H35NO6Si/c1-6-29-21(26)20-18(12-14-23(2,3)31(4,5)28)24(15-13-19(20)25)22(27)30-16-17-10-8-7-9-11-17/h7-11,18,20,28H,6,12-16H2,1-5H3 |
| InChIKey | WKNHAEWQJMSPSE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate?
The IUPAC name of 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate (CID 66596169) is 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate?
The canonical SMILES for 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate is CCOC(=O)C1C(=O)CCN(C(=O)OCc2ccccc2)C1CCC(C)(C)[Si](C)(C)O.
What is the InChIKey of 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate?
The InChIKey is WKNHAEWQJMSPSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NO6Si/c1-6-29-21(26)20-18(12-14-23(2,3)31(4,5)28)24(15-13-19(20)25)22(27)30-16-17-10-8-7-9-11-17/h7-11,18,20,28H,6,12-16H2,1-5H3.
What are the key properties of 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate?
1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate has a molecular weight of 449.62 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 3-O-ethyl 2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-4-oxopiperidine-1,3-dicarboxylate is sourced from PubChem (CID 66596169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).