C31H32ClIN2O3 — CID 66596172
(6S)-N-[(2-chloro-3-iodophenyl)methyl]-N-cyclopropyl-6-(methoxymethoxymethyl)-4-(3-phenylphenyl)-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 66596172) has the molecular formula C31H32ClIN2O3 and a molecular weight of 642.97 g/mol. Its IUPAC name is (6S)-N-[(2-chloro-3-iodophenyl)methyl]-N-cyclopropyl-6-(methoxymethoxymethyl)-4-(3-phenylphenyl)-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | (6S)-N-[(2-chloro-3-iodophenyl)methyl]-N-cyclopropyl-6-(methoxymethoxymethyl)-4-(3-phenylphenyl)-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 66596172 |
| Molecular Formula | C31H32ClIN2O3 |
| Molecular Weight | 642.97 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | (6S)-N-[(2-chloro-3-iodophenyl)methyl]-N-cyclopropyl-6-(methoxymethoxymethyl)-4-(3-phenylphenyl)-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | COCOC[C@H]1NCCC(c2cccc(-c3ccccc3)c2)=C1C(=O)N(Cc1cccc(I)c1Cl)C1CC1 |
| InChI | InChI=1S/C31H32ClIN2O3/c1-37-20-38-19-28-29(31(36)35(25-13-14-25)18-24-11-6-12-27(33)30(24)32)26(15-16-34-28)23-10-5-9-22(17-23)21-7-3-2-4-8-21/h2-12,17,25,28,34H,13-16,18-20H2,1H3/t28-/m1/s1 |
| InChIKey | WFLXWVKCDUICDE-MUUNZHRXSA-N |
| XLogP | 6.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.97 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|