C10H18O — CID 66596853
1-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 66596853) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 1-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 66596853 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 1-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | COC1CCC2CCCCC21 |
| InChI | InChI=1S/C10H18O/c1-11-10-7-6-8-4-2-3-5-9(8)10/h8-10H,2-7H2,1H3 |
| InChIKey | GUUCMVRZFHXPAD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |