C11H16N4O4 — CID 66596990
(2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;6-methyl-7H-purine (PubChem CID 66596990) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;6-methyl-7H-purine.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;6-methyl-7H-purine |
|---|---|
| PubChem CID | 66596990 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;6-methyl-7H-purine |
| SMILES | Cc1ncnc2nc[nH]c12.OC[C@H]1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H6N4.C5H10O4/c1-4-5-6(9-2-7-4)10-3-8-5;6-1-4-5(8)3(7)2-9-4/h2-3H,1H3,(H,7,8,9,10);3-8H,1-2H2/t;3-,4+,5-/m.0/s1 |
| InChIKey | AJCRHYNHNDHSLZ-HEEXEHOYSA-N |
| XLogP | -1.24 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |