C15H22F2O4 — CID 66596991
4,4-difluoropentyl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 66596991) has the molecular formula C15H22F2O4 and a molecular weight of 304.33 g/mol. Its IUPAC name is 4,4-difluoropentyl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | 4,4-difluoropentyl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 66596991 |
| Molecular Formula | C15H22F2O4 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4,4-difluoropentyl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC(F)(F)CCCOC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C15H22F2O4/c1-12(2)13(3)7-8-15(12,21-10(13)18)11(19)20-9-5-6-14(4,16)17/h5-9H2,1-4H3 |
| InChIKey | ZAIJDFKPQAYZKA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|