C27H38F3N5O3Si — CID 66597725
2-[[4-[1-(1-cyclopentyl-2-cyclopropylethyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane;2,2,2-trifluoroacetic acid (PubChem CID 66597725) has the molecular formula C27H38F3N5O3Si and a molecular weight of 565.71 g/mol. Its IUPAC name is 2-[[4-[1-(1-cyclopentyl-2-cyclopropylethyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[4-[1-(1-cyclopentyl-2-cyclopropylethyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66597725 |
| Molecular Formula | C27H38F3N5O3Si |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-[[4-[1-(1-cyclopentyl-2-cyclopropylethyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane;2,2,2-trifluoroacetic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC4CC4)C4CCCC4)c3)ncnc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H37N5OSi.C2HF3O2/c1-32(2,3)13-12-31-18-29-11-10-22-24(26-17-27-25(22)29)21-15-28-30(16-21)23(14-19-8-9-19)20-6-4-5-7-20;3-2(4,5)1(6)7/h10-11,15-17,19-20,23H,4-9,12-14,18H2,1-3H3;(H,6,7) |
| InChIKey | ODEDCJPNUBJGHT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|