C25H28N6O3Si — CID 66597845
3-[2-cyano-1-[4-[2-methyl-7-(2-trimethylsilylethoxy)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]benzoic acid (PubChem CID 66597845) has the molecular formula C25H28N6O3Si and a molecular weight of 488.62 g/mol. Its IUPAC name is 3-[2-cyano-1-[4-[2-methyl-7-(2-trimethylsilylethoxy)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]benzoic acid.
| Compound Name | 3-[2-cyano-1-[4-[2-methyl-7-(2-trimethylsilylethoxy)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 66597845 |
| Molecular Formula | C25H28N6O3Si |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 3-[2-cyano-1-[4-[2-methyl-7-(2-trimethylsilylethoxy)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]benzoic acid |
| SMILES | Cc1nc(-c2cnn(C(CC#N)c3cccc(C(=O)O)c3)c2)c2ccn(OCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C25H28N6O3Si/c1-17-28-23(21-9-11-31(24(21)29-17)34-12-13-35(2,3)4)20-15-27-30(16-20)22(8-10-26)18-6-5-7-19(14-18)25(32)33/h5-7,9,11,14-16,22H,8,12-13H2,1-4H3,(H,32,33) |
| InChIKey | HSGRYYIBCCZSNI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|