C42H49N5O2Si — CID 66598137
trimethyl-[2-[[4-[1-[4-(2-trityloxyethyl)cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane (PubChem CID 66598137) has the molecular formula C42H49N5O2Si and a molecular weight of 683.97 g/mol. Its IUPAC name is trimethyl-[2-[[4-[1-[4-(2-trityloxyethyl)cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-[1-[4-(2-trityloxyethyl)cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 66598137 |
| Molecular Formula | C42H49N5O2Si |
| Molecular Weight | 683.97 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | trimethyl-[2-[[4-[1-[4-(2-trityloxyethyl)cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4CCC(CCOC(c5ccccc5)(c5ccccc5)c5ccccc5)CC4)c3)ncnc21 |
| InChI | InChI=1S/C42H49N5O2Si/c1-50(2,3)28-27-48-32-46-25-23-39-40(43-31-44-41(39)46)34-29-45-47(30-34)38-21-19-33(20-22-38)24-26-49-42(35-13-7-4-8-14-35,36-15-9-5-10-16-36)37-17-11-6-12-18-37/h4-18,23,25,29-31,33,38H,19-22,24,26-28,32H2,1-3H3 |
| InChIKey | HIODGDOULCSXHA-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.97 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|