About 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one
10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one (PubChem CID 66598494) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one.
Molecular Properties
| Compound Name | 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one |
| PubChem CID | 66598494 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one |
| SMILES | CCN1C2C=CC=CC2C(=O)C2C=CC=CC21 |
| InChI | InChI=1S/C15H17NO/c1-2-16-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)16/h3-14H,2H2,1H3 |
| InChIKey | ZEYIUDFSRAGGFI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one?
The IUPAC name of 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one (CID 66598494) is 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one.
What is the SMILES notation for 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one?
The canonical SMILES for 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one is CCN1C2C=CC=CC2C(=O)C2C=CC=CC21.
What is the InChIKey of 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one?
The InChIKey is ZEYIUDFSRAGGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-2-16-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)16/h3-14H,2H2,1H3.
What are the key properties of 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one?
10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one has a molecular weight of 227.31 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethyl-4a,8a,9a,10a-tetrahydroacridin-9-one is sourced from PubChem (CID 66598494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).