About bis(triphenyl-λ4-sulfanyl) butanedioate
bis(triphenyl-λ4-sulfanyl) butanedioate (PubChem CID 66598639) has the molecular formula C40H34O4S2
and a molecular weight of 642.84 g/mol. Its IUPAC name is bis(triphenyl-λ4-sulfanyl) butanedioate.
Molecular Properties
| Compound Name | bis(triphenyl-λ4-sulfanyl) butanedioate |
| PubChem CID | 66598639 |
| Molecular Formula | C40H34O4S2 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | bis(triphenyl-λ4-sulfanyl) butanedioate |
| SMILES | O=C(CCC(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H34O4S2/c41-39(43-45(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35)31-32-40(42)44-46(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30H,31-32H2 |
| InChIKey | RBPOVLHQKFABHJ-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(triphenyl-λ4-sulfanyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(triphenyl-λ4-sulfanyl) butanedioate?
The IUPAC name of bis(triphenyl-λ4-sulfanyl) butanedioate (CID 66598639) is bis(triphenyl-λ4-sulfanyl) butanedioate.
What is the SMILES notation for bis(triphenyl-λ4-sulfanyl) butanedioate?
The canonical SMILES for bis(triphenyl-λ4-sulfanyl) butanedioate is O=C(CCC(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of bis(triphenyl-λ4-sulfanyl) butanedioate?
The InChIKey is RBPOVLHQKFABHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H34O4S2/c41-39(43-45(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35)31-32-40(42)44-46(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30H,31-32H2.
What are the key properties of bis(triphenyl-λ4-sulfanyl) butanedioate?
bis(triphenyl-λ4-sulfanyl) butanedioate has a molecular weight of 642.84 g/mol, XLogP of 10.65, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(triphenyl-λ4-sulfanyl) butanedioate is sourced from PubChem (CID 66598639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).