About tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate
tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate (PubChem CID 66598720) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate |
| PubChem CID | 66598720 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2C(=O)Nc3ccccc3C2O)CC1 |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,3)25-18(24)21-10-8-12(9-11-21)15-16(22)13-6-4-5-7-14(13)20-17(15)23/h4-7,12,15-16,22H,8-11H2,1-3H3,(H,20,23) |
| InChIKey | GJMOZYCZQHMRRA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate (CID 66598720) is tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C2C(=O)Nc3ccccc3C2O)CC1.
What is the InChIKey of tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate?
The InChIKey is GJMOZYCZQHMRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-19(2,3)25-18(24)21-10-8-12(9-11-21)15-16(22)13-6-4-5-7-14(13)20-17(15)23/h4-7,12,15-16,22H,8-11H2,1-3H3,(H,20,23).
What are the key properties of tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate?
tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate has a molecular weight of 346.43 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(4-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)piperidine-1-carboxylate is sourced from PubChem (CID 66598720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).