About 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane
3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane (PubChem CID 66598847) has the molecular formula C17H32O3Si
and a molecular weight of 312.53 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane.
Molecular Properties
| Compound Name | 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane |
| PubChem CID | 66598847 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane |
| SMILES | CCCO[Si](CCCC1=CC=CC1)(OCCC)OCCC |
| InChI | InChI=1S/C17H32O3Si/c1-4-13-18-21(19-14-5-2,20-15-6-3)16-9-12-17-10-7-8-11-17/h7-8,10H,4-6,9,11-16H2,1-3H3 |
| InChIKey | DVUSIBKDYUOUMC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane?
The IUPAC name of 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane (CID 66598847) is 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane.
What is the SMILES notation for 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane?
The canonical SMILES for 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane is CCCO[Si](CCCC1=CC=CC1)(OCCC)OCCC.
What is the InChIKey of 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane?
The InChIKey is DVUSIBKDYUOUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3Si/c1-4-13-18-21(19-14-5-2,20-15-6-3)16-9-12-17-10-7-8-11-17/h7-8,10H,4-6,9,11-16H2,1-3H3.
What are the key properties of 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane?
3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane has a molecular weight of 312.53 g/mol, XLogP of 4.87, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-1,3-dien-1-ylpropyl(tripropoxy)silane is sourced from PubChem (CID 66598847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).