C14H9Cl2FN6OS — CID 66599055
(2,3-dichloro-4-fluorophenyl)-[3-(1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 66599055) has the molecular formula C14H9Cl2FN6OS and a molecular weight of 399.24 g/mol. Its IUPAC name is (2,3-dichloro-4-fluorophenyl)-[3-(1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (2,3-dichloro-4-fluorophenyl)-[3-(1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 66599055 |
| Molecular Formula | C14H9Cl2FN6OS |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | (2,3-dichloro-4-fluorophenyl)-[3-(1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1Cl)N1CCn2c(nnc2-c2ncns2)C1 |
| InChI | InChI=1S/C14H9Cl2FN6OS/c15-10-7(1-2-8(17)11(10)16)14(24)22-3-4-23-9(5-22)20-21-12(23)13-18-6-19-25-13/h1-2,6H,3-5H2 |
| InChIKey | VXPPZGZOYDRITK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|