C16H13Cl2N5O2 — CID 66599096
(2,3-dichlorophenyl)-[3-(5-methyl-1,2-oxazol-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 66599096) has the molecular formula C16H13Cl2N5O2 and a molecular weight of 378.22 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[3-(5-methyl-1,2-oxazol-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[3-(5-methyl-1,2-oxazol-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 66599096 |
| Molecular Formula | C16H13Cl2N5O2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2,3-dichlorophenyl)-[3-(5-methyl-1,2-oxazol-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | Cc1cc(-c2nnc3n2CCN(C(=O)c2cccc(Cl)c2Cl)C3)no1 |
| InChI | InChI=1S/C16H13Cl2N5O2/c1-9-7-12(21-25-9)15-20-19-13-8-22(5-6-23(13)15)16(24)10-3-2-4-11(17)14(10)18/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | LOTRNBAVJZGHGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |