C26H26N4O2 — CID 66599413
5-(3-methoxyphenyl)-2-[4-(4-methylpiperazine-1-carbonyl)anilino]benzonitrile (PubChem CID 66599413) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-2-[4-(4-methylpiperazine-1-carbonyl)anilino]benzonitrile.
| Compound Name | 5-(3-methoxyphenyl)-2-[4-(4-methylpiperazine-1-carbonyl)anilino]benzonitrile |
|---|---|
| PubChem CID | 66599413 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 5-(3-methoxyphenyl)-2-[4-(4-methylpiperazine-1-carbonyl)anilino]benzonitrile |
| SMILES | COc1cccc(-c2ccc(Nc3ccc(C(=O)N4CCN(C)CC4)cc3)c(C#N)c2)c1 |
| InChI | InChI=1S/C26H26N4O2/c1-29-12-14-30(15-13-29)26(31)19-6-9-23(10-7-19)28-25-11-8-21(16-22(25)18-27)20-4-3-5-24(17-20)32-2/h3-11,16-17,28H,12-15H2,1-2H3 |
| InChIKey | HRRVYMAPZYOSGF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |