About tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate
tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate (PubChem CID 66599421) has the molecular formula C14H23N5O2
and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate |
| PubChem CID | 66599421 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc(N)c(N)n2)C1 |
| InChI | InChI=1S/C14H23N5O2/c1-14(2,3)21-13(20)17-9-6-7-19(8-9)11-5-4-10(15)12(16)18-11/h4-5,9H,6-8,15H2,1-3H3,(H2,16,18)(H,17,20) |
| InChIKey | GXBIJASGFOJTTH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate (CID 66599421) is tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate is CC(C)(C)OC(=O)NC1CCN(c2ccc(N)c(N)n2)C1.
What is the InChIKey of tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate?
The InChIKey is GXBIJASGFOJTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2/c1-14(2,3)21-13(20)17-9-6-7-19(8-9)11-5-4-10(15)12(16)18-11/h4-5,9H,6-8,15H2,1-3H3,(H2,16,18)(H,17,20).
What are the key properties of tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate?
tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate has a molecular weight of 293.37 g/mol, XLogP of 1.35, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(5,6-diamino-2-pyridinyl)pyrrolidin-3-yl]carbamate is sourced from PubChem (CID 66599421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).