About tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate
tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate (PubChem CID 66599834) has the molecular formula C21H31F2N3O4
and a molecular weight of 427.49 g/mol. Its IUPAC name is tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate |
| PubChem CID | 66599834 |
| Molecular Formula | C21H31F2N3O4 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N2CCC(F)(F)CC2)cc(COC2CCCCO2)n1 |
| InChI | InChI=1S/C21H31F2N3O4/c1-20(2,3)30-19(27)25-17-13-16(26-9-7-21(22,23)8-10-26)12-15(24-17)14-29-18-6-4-5-11-28-18/h12-13,18H,4-11,14H2,1-3H3,(H,24,25,27) |
| InChIKey | WXVGSTKMOBFFCF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate?
The IUPAC name of tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate (CID 66599834) is tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate?
The canonical SMILES for tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate is CC(C)(C)OC(=O)Nc1cc(N2CCC(F)(F)CC2)cc(COC2CCCCO2)n1.
What is the InChIKey of tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate?
The InChIKey is WXVGSTKMOBFFCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31F2N3O4/c1-20(2,3)30-19(27)25-17-13-16(26-9-7-21(22,23)8-10-26)12-15(24-17)14-29-18-6-4-5-11-28-18/h12-13,18H,4-11,14H2,1-3H3,(H,24,25,27).
What are the key properties of tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate?
tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate has a molecular weight of 427.49 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(4,4-difluoropiperidin-1-yl)-6-(oxan-2-yloxymethyl)-2-pyridinyl]carbamate is sourced from PubChem (CID 66599834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).