C29H36BN3O5 — CID 66600428
6-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one (PubChem CID 66600428) has the molecular formula C29H36BN3O5 and a molecular weight of 517.44 g/mol. Its IUPAC name is 6-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one.
| Compound Name | 6-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 66600428 |
| Molecular Formula | C29H36BN3O5 |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 6-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
| SMILES | Cc1nnc(CCC2(c3ccccc3)CCN([C@@H](C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)C(=O)O2)o1 |
| InChI | InChI=1S/C29H36BN3O5/c1-20(22-12-14-24(15-13-22)30-37-27(3,4)28(5,6)38-30)33-19-18-29(36-26(33)34,23-10-8-7-9-11-23)17-16-25-32-31-21(2)35-25/h7-15,20H,16-19H2,1-6H3/t20-,29?/m0/s1 |
| InChIKey | GYVMVYRTANIIBY-OORIHMLWSA-N |
| XLogP | 5.11 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|