About 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol
4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol (PubChem CID 66601020) has the molecular formula C24H31N3O3
and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol |
| PubChem CID | 66601020 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol |
| SMILES | CCCCCC(CC)Oc1ccccc1O.COc1ccccc1-c1ccnnn1 |
| InChI | InChI=1S/C14H22O2.C10H9N3O/c1-3-5-6-9-12(4-2)16-14-11-8-7-10-13(14)15;1-14-10-5-3-2-4-8(10)9-6-7-11-13-12-9/h7-8,10-12,15H,3-6,9H2,1-2H3;2-7H,1H3 |
| InChIKey | MMIYRBMULXATNO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol?
The IUPAC name of 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol (CID 66601020) is 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol.
What is the SMILES notation for 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol?
The canonical SMILES for 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol is CCCCCC(CC)Oc1ccccc1O.COc1ccccc1-c1ccnnn1.
What is the InChIKey of 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol?
The InChIKey is MMIYRBMULXATNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2.C10H9N3O/c1-3-5-6-9-12(4-2)16-14-11-8-7-10-13(14)15;1-14-10-5-3-2-4-8(10)9-6-7-11-13-12-9/h7-8,10-12,15H,3-6,9H2,1-2H3;2-7H,1H3.
What are the key properties of 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol?
4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol has a molecular weight of 409.53 g/mol, XLogP of 5.68, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)triazine;2-octan-3-yloxyphenol is sourced from PubChem (CID 66601020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).