C29H40BNO5 — CID 66601065
6-(2-hydroxy-2-methylpropyl)-3-[(1S)-1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-6-phenyl-1,3-oxazinan-2-one (PubChem CID 66601065) has the molecular formula C29H40BNO5 and a molecular weight of 493.45 g/mol. Its IUPAC name is 6-(2-hydroxy-2-methylpropyl)-3-[(1S)-1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-6-phenyl-1,3-oxazinan-2-one.
| Compound Name | 6-(2-hydroxy-2-methylpropyl)-3-[(1S)-1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-6-phenyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 66601065 |
| Molecular Formula | C29H40BNO5 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 6-(2-hydroxy-2-methylpropyl)-3-[(1S)-1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-6-phenyl-1,3-oxazinan-2-one |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1[C@H](C)N1CCC(CC(C)(C)O)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C29H40BNO5/c1-20-18-23(30-35-27(5,6)28(7,8)36-30)14-15-24(20)21(2)31-17-16-29(34-25(31)32,19-26(3,4)33)22-12-10-9-11-13-22/h9-15,18,21,33H,16-17,19H2,1-8H3/t21-,29?/m0/s1 |
| InChIKey | WIZVIOZJPALPDC-TYKNXJODSA-N |
| XLogP | 5.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|