C20H14F4N2O4S — CID 66601076
4-[benzyl-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]sulfamoyl]benzoic acid (PubChem CID 66601076) has the molecular formula C20H14F4N2O4S and a molecular weight of 454.40 g/mol. Its IUPAC name is 4-[benzyl-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[benzyl-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66601076 |
| Molecular Formula | C20H14F4N2O4S |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 4-[benzyl-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cc2ccccc2)c2ncc(C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C20H14F4N2O4S/c21-17-10-15(20(22,23)24)11-25-18(17)26(12-13-4-2-1-3-5-13)31(29,30)16-8-6-14(7-9-16)19(27)28/h1-11H,12H2,(H,27,28) |
| InChIKey | VBEONWICTOPKBL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |