About bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate
bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate (PubChem CID 66601139) has the molecular formula C24H19BrF4O4
and a molecular weight of 527.31 g/mol. Its IUPAC name is bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate |
| PubChem CID | 66601139 |
| Molecular Formula | C24H19BrF4O4 |
| Molecular Weight | 527.31 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate |
| SMILES | CBr.O=C(OCC(=CO)c1ccccc1)C(O)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H16F4O4.CH3Br/c24-18-8-6-16(10-20(18)26)23(30,17-7-9-19(25)21(27)11-17)22(29)31-13-15(12-28)14-4-2-1-3-5-14;1-2/h1-12,28,30H,13H2;1H3 |
| InChIKey | UDWUKQMXMGHAMY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate?
The IUPAC name of bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate (CID 66601139) is bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate.
What is the SMILES notation for bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate?
The canonical SMILES for bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate is CBr.O=C(OCC(=CO)c1ccccc1)C(O)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1.
What is the InChIKey of bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate?
The InChIKey is UDWUKQMXMGHAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F4O4.CH3Br/c24-18-8-6-16(10-20(18)26)23(30,17-7-9-19(25)21(27)11-17)22(29)31-13-15(12-28)14-4-2-1-3-5-14;1-2/h1-12,28,30H,13H2;1H3.
What are the key properties of bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate?
bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate has a molecular weight of 527.31 g/mol, XLogP of 5.63, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;(3-hydroxy-2-phenylprop-2-enyl) 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate is sourced from PubChem (CID 66601139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).