About 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid
5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66601491) has the molecular formula C8H12N3O2PS
and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 66601491 |
| Molecular Formula | C8H12N3O2PS |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1CNC1CN(P)C1 |
| InChI | InChI=1S/C8H12N3O2PS/c12-8(13)7-6(15-4-10-7)1-9-5-2-11(14)3-5/h4-5,9H,1-3,14H2,(H,12,13) |
| InChIKey | ZTOLHOIKEQPTBW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid (CID 66601491) is 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1CNC1CN(P)C1.
What is the InChIKey of 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is ZTOLHOIKEQPTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N3O2PS/c12-8(13)7-6(15-4-10-7)1-9-5-2-11(14)3-5/h4-5,9H,1-3,14H2,(H,12,13).
What are the key properties of 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid?
5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 245.24 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1-phosphanylazetidin-3-yl)amino]methyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 66601491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).