C31H47F2N3O6Si2 — CID 66602291
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-methoxyethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602291) has the molecular formula C31H47F2N3O6Si2 and a molecular weight of 651.90 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-methoxyethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-methoxyethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602291 |
| Molecular Formula | C31H47F2N3O6Si2 |
| Molecular Weight | 651.90 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-methoxyethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | COCCc1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cnn(COCC[Si](C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C31H47F2N3O6Si2/c1-38-13-12-24-28-25(19-34-36(30(28)37)21-40-15-17-44(5,6)7)35(20-39-14-16-43(2,3)4)29(24)22-8-11-26(42-31(32)33)27(18-22)41-23-9-10-23/h8,11,18-19,23,31H,9-10,12-17,20-21H2,1-7H3 |
| InChIKey | OOIJRASRUYAWQZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 85.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.90 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|