C32H47F2N3O6Si2 — CID 66602353
3-cyclopropyl-2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-7-(hydroxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602353) has the molecular formula C32H47F2N3O6Si2 and a molecular weight of 663.91 g/mol. Its IUPAC name is 3-cyclopropyl-2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-7-(hydroxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 3-cyclopropyl-2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-7-(hydroxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602353 |
| Molecular Formula | C32H47F2N3O6Si2 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | 3-cyclopropyl-2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-7-(hydroxymethyl)-1,5-bis(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1nc(CO)c2c(c(C3CC3)c(-c3ccc(OC(F)F)c(OC4CC4)c3)n2COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C32H47F2N3O6Si2/c1-44(2,3)15-13-40-19-36-29(22-9-12-25(43-32(33)34)26(17-22)42-23-10-11-23)27(21-7-8-21)28-30(36)24(18-38)35-37(31(28)39)20-41-14-16-45(4,5)6/h9,12,17,21,23,32,38H,7-8,10-11,13-16,18-20H2,1-6H3 |
| InChIKey | NETATFDYDAVAEQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|