C30H41F2N3O4Si2 — CID 66602431
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-triethylsilylethynyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602431) has the molecular formula C30H41F2N3O4Si2 and a molecular weight of 601.84 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-triethylsilylethynyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-triethylsilylethynyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602431 |
| Molecular Formula | C30H41F2N3O4Si2 |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-(2-triethylsilylethynyl)-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CC[Si](C#Cc1c(-c2ccc(OC(F)F)c(OC3CC3)c2)n(COCC[Si](C)(C)C)c2cn[nH]c(=O)c12)(CC)CC |
| InChI | InChI=1S/C30H41F2N3O4Si2/c1-7-41(8-2,9-3)16-14-23-27-24(19-33-34-29(27)36)35(20-37-15-17-40(4,5)6)28(23)21-10-13-25(39-30(31)32)26(18-21)38-22-11-12-22/h10,13,18-19,22,30H,7-9,11-12,15,17,20H2,1-6H3,(H,34,36) |
| InChIKey | GPNIFVLEUDISOF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|